| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (631) 485-4226 | |||
![]() |
info@bocsci.com | |||
![]() |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| CacheSyn Inc. | Canada | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (416) 996-8186 | |||
![]() |
info@cachesyn.com | |||
| Chemical manufacturer | ||||
| Santa Cruz Biotechnology, Inc. | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (831) 457-3800 | |||
![]() |
scbt@scbt.com | |||
| Chemical manufacturer | ||||
| Classification | Analytical chemistry >> Standard >> Pharmacopoeia standards and magazine standards |
|---|---|
| Name | 13-cis-Acitretin |
| Synonyms | (2Z,4E,6E,8E)-9-(4-Methoxy-2,3,6-Trimethyl-Phenyl)-3,7-Dimethyl-Nona-2,4,6,8-Tetraenoic Acid; 2,4,6,8-Noneatetraenoic Acid, 9-(4-Methoxy-2,3,6-Trimethylphenyl)-3,7-Dimethyl-, (Z,E,E,E)-; Isoacitretin |
| Molecular Structure | ![]() |
| Molecular Formula | C21H26O3 |
| Molecular Weight | 326.43 |
| CAS Registry Number | 69427-46-9 |
| SMILES | C1=C(C(=C(C(=C1C)\C=C\C(=C\C=C\C(=C/C(O)=O)C)C)C)C)OC |
| InChI | 1S/C21H26O3/c1-14(8-7-9-15(2)12-21(22)23)10-11-19-16(3)13-20(24-6)18(5)17(19)4/h7-13H,1-6H3,(H,22,23)/b9-7+,11-10+,14-8+,15-12- |
| InChIKey | IHUNBGSDBOWDMA-UGOGCBOOSA-N |
| Density | 1.052g/cm3 (Cal.) |
|---|---|
| Boiling point | 521.31°C at 760 mmHg (Cal.) |
| Flash point | 180.275°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 13-cis-Acitretin |