Online Database of Chemicals from Around the World
|
CAS#: 6957-71-7 Product: 2-Formylaminofluorene No suppilers available for the product. |
| Name | 2-Formylaminofluorene |
|---|---|
| Synonyms | N-(9H-Fluoren-2-Yl)Methanamide; 2-Formylaminofluorene; Formamide, N-9H-Fluoren-2-Yl- |
| Molecular Structure |  |
| Molecular Formula | C14H11NO |
| Molecular Weight | 209.25 |
| CAS Registry Number | 6957-71-7 |
| SMILES | C3=C2C1=C(C=CC=C1)CC2=CC(=C3)NC=O |
| InChI | 1S/C14H11NO/c16-9-15-12-5-6-14-11(8-12)7-10-3-1-2-4-13(10)14/h1-6,8-9H,7H2,(H,15,16) |
| InChIKey | DOSNGAGLKBWUSU-UHFFFAOYSA-N |
| Density | 1.267g/cm3 (Cal.) |
|---|---|
| Boiling point | 452.368°C at 760 mmHg (Cal.) |
| Flash point | 269.59°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 2-Formylaminofluorene |