Online Database of Chemicals from Around the World
|
CAS#: 83591-99-5 Product: N-Formylaminoglutethimide No suppilers available for the product. |
| Name | N-Formylaminoglutethimide |
|---|---|
| Synonyms | N-[4-(3-Ethyl-2,6-Dioxo-3-Piperidyl)Phenyl]Formamide; N-[4-(3-Ethyl-2,6-Dioxo-3-Piperidinyl)Phenyl]Formamide; N-[4-(3-Ethyl-2,6-Diketo-3-Piperidyl)Phenyl]Formamide |
| Molecular Structure |  |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 |
| CAS Registry Number | 83591-99-5 |
| SMILES | C1=CC(=CC=C1NC=O)C2(C(NC(CC2)=O)=O)CC |
| InChI | 1S/C14H16N2O3/c1-2-14(8-7-12(18)16-13(14)19)10-3-5-11(6-4-10)15-9-17/h3-6,9H,2,7-8H2,1H3,(H,15,17)(H,16,18,19) |
| InChIKey | JDYFACIKDPJKEB-UHFFFAOYSA-N |
| Density | 1.225g/cm3 (Cal.) |
|---|---|
| Boiling point | 523.41°C at 760 mmHg (Cal.) |
| Flash point | 213.316°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Formylaminoglutethimide |