Online Database of Chemicals from Around the World
|
CAS#: 69795-73-9 Product: 3-Hydroxy-3,4-Dihydrocyclopenta(cd)Pyrene No suppilers available for the product. |
| Name | 3-Hydroxy-3,4-Dihydrocyclopenta(cd)Pyrene |
|---|---|
| Synonyms | Ccris 7294; Cyclopenta(Cd)Pyren-3-Ol, 3,4-Dihydro-; 3,4-Dihydrocyclopenta(Cd)Pyren-3-Ol |
| Molecular Structure |  |
| Molecular Formula | C18H12O |
| Molecular Weight | 244.29 |
| CAS Registry Number | 69795-73-9 |
| SMILES | C1=CC5=C2C(=CC3=CC=CC4=CC=C1C2=C34)CC5O |
| InChI | 1S/C18H12O/c19-15-9-13-8-12-3-1-2-10-4-5-11-6-7-14(15)17(13)18(11)16(10)12/h1-8,15,19H,9H2 |
| InChIKey | PRQSBOQMCBPXTR-UHFFFAOYSA-N |
| Density | 1.434g/cm3 (Cal.) |
|---|---|
| Boiling point | 498.608°C at 760 mmHg (Cal.) |
| Flash point | 179.649°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Hydroxy-3,4-Dihydrocyclopenta(cd)Pyrene |