Online Database of Chemicals from Around the World
|
CAS#: 7183-69-9 Product: 14-Hydroxydihydrocodeine No suppilers available for the product. |
| Name | 14-Hydroxydihydrocodeine |
|---|---|
| Synonyms | Codeine-A, Dihydrohydroxy-; Codeine-C, Dihydrohydroxy; Dihydrohydroxycodeine-A |
| Molecular Structure |  |
| Molecular Formula | C18H23NO4 |
| Molecular Weight | 317.38 |
| CAS Registry Number | 7183-69-9 |
| SMILES | [C@@]125C3=C4C[C@H]([C@@]1(CC[C@@H]([C@@H]2OC3=C(C=C4)OC)O)O)N(CC5)C |
| InChI | 1S/C18H23NO4/c1-19-8-7-17-14-10-3-4-12(22-2)15(14)23-16(17)11(20)5-6-18(17,21)13(19)9-10/h3-4,11,13,16,20-21H,5-9H2,1-2H3/t11-,13+,16-,17-,18+/m0/s1 |
| InChIKey | LHTAJTFGGUDLRH-QMVVXIJUSA-N |
| Density | 1.402g/cm3 (Cal.) |
|---|---|
| Boiling point | 501.492°C at 760 mmHg (Cal.) |
| Flash point | 257.093°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 14-Hydroxydihydrocodeine |