Online Database of Chemicals from Around the World
|
CAS#: 70190-99-7 Product: N-Lactoyl-L-alanine No suppilers available for the product. |
| Name | N-Lactoyl-L-alanine |
|---|---|
| Synonyms | (2S)-2-(2-hydroxypropanamido)propanoic acid |
| Molecular Structure |  |
| Molecular Formula | C6H11NO4 |
| Molecular Weight | 161.16 |
| CAS Registry Number | 70190-99-7 |
| SMILES | C[C@@H](C(=O)O)NC(=O)C(C)O |
| InChI | 1S/C6H11NO4/c1-3(6(10)11)7-5(9)4(2)8/h3-4,8H,1-2H3,(H,7,9)(H,10,11)/t3-,4?/m0/s1 |
| InChIKey | WOCQGWHMXPRWHW-WUCPZUCCSA-N |
| Density | 1.275g/cm3 (Cal.) |
|---|---|
| Boiling point | 428.803°C at 760 mmHg (Cal.) |
| Flash point | 213.132°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Lactoyl-L-alanine |