Online Database of Chemicals from Around the World
| Otava Ltd. | Ukraine | Inquire | ||
|---|---|---|---|---|
 |
+380 (44) 522-2458 | |||
 |
order@otavachemicals.com | |||
| Chemical manufacturer since 1997 | ||||
| Name | p-Lactotoluidide |
|---|---|
| Synonyms | 2-Hydroxy-N-(4-Methylphenyl)Propionamide; P-Lactotoluidide |
| Molecular Structure |  |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 |
| CAS Registry Number | 71173-20-1 |
| SMILES | C1=CC(=CC=C1C)NC(=O)C(O)C |
| InChI | 1S/C10H13NO2/c1-7-3-5-9(6-4-7)11-10(13)8(2)12/h3-6,8,12H,1-2H3,(H,11,13) |
| InChIKey | RQZWJSBSLKHGPF-UHFFFAOYSA-N |
| Density | 1.17g/cm3 (Cal.) |
|---|---|
| Boiling point | 368.816°C at 760 mmHg (Cal.) |
| Flash point | 176.854°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for p-Lactotoluidide |