Online Database of Chemicals from Around the World
|
CAS#: 703-46-8 Product: 5-Mercaptopyridoxine No suppilers available for the product. |
| Name | 5-Mercaptopyridoxine |
|---|---|
| Synonyms | 4-Methoxy-2-Methyl-5-Methylsulfanyl-Pyridin-3-Ol; 4-Methoxy-2-Methyl-5-(Methylthio)-3-Pyridinol; 4-Methoxy-2-Methyl-5-(Methylthio)Pyridin-3-Ol |
| Molecular Structure |  |
| Molecular Formula | C8H11NO2S |
| Molecular Weight | 185.24 |
| CAS Registry Number | 703-46-8 |
| SMILES | C1=C(C(=C(C(=N1)C)O)OC)SC |
| InChI | 1S/C8H11NO2S/c1-5-7(10)8(11-2)6(12-3)4-9-5/h4,10H,1-3H3 |
| InChIKey | PZTHSDYEYQLIDM-UHFFFAOYSA-N |
| Density | 1.244g/cm3 (Cal.) |
|---|---|
| Boiling point | 366.099°C at 760 mmHg (Cal.) |
| Flash point | 175.21°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 5-Mercaptopyridoxine |