Online Database of Chemicals from Around the World
|
CAS#: 99780-72-0 Product: 3-Mercapto-2-Pyridinesulfonamide No suppilers available for the product. |
| Name | 3-Mercapto-2-Pyridinesulfonamide |
|---|---|
| Synonyms | 3-Mercapto-2-Pyridinesulfonamide; 3-Mercaptopyridine-2-Sulfonamide; 2-Pyridinesulfonamide, 3-Mercapto- |
| Molecular Structure |  |
| Molecular Formula | C5H6N2O2S2 |
| Molecular Weight | 190.23 |
| CAS Registry Number | 99780-72-0 |
| SMILES | C1=CC=C(C(=N1)[S](=O)(=O)N)S |
| InChI | 1S/C5H6N2O2S2/c6-11(8,9)5-4(10)2-1-3-7-5/h1-3,10H,(H2,6,8,9) |
| InChIKey | XXONZJKORUUFIZ-UHFFFAOYSA-N |
| Density | 1.532g/cm3 (Cal.) |
|---|---|
| Boiling point | 417.479°C at 760 mmHg (Cal.) |
| Flash point | 206.284°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Mercapto-2-Pyridinesulfonamide |