Online Database of Chemicals from Around the World
|
CAS#: 70521-94-7 Product: Sesbanine No suppilers available for the product. |
| Name | Sesbanine |
|---|---|
| Synonyms | 3'-Hydroxyspiro[2,7-Naphthyridine-4,1'-Cyclopentane]-1,3-Quinone; (+)-Sesbanine; Nsc324609 |
| Molecular Structure |  |
| Molecular Formula | C12H12N2O3 |
| Molecular Weight | 232.24 |
| CAS Registry Number | 70521-94-7 |
| SMILES | C1=C2C(=CC=N1)C3(C(NC2=O)=O)CCC(C3)O |
| InChI | 1S/C12H12N2O3/c15-7-1-3-12(5-7)9-2-4-13-6-8(9)10(16)14-11(12)17/h2,4,6-7,15H,1,3,5H2,(H,14,16,17) |
| InChIKey | UETOAKFPMASNTK-UHFFFAOYSA-N |
| Density | 1.449g/cm3 (Cal.) |
|---|---|
| Boiling point | 528.26°C at 760 mmHg (Cal.) |
| Flash point | 273.282°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Sesbanine |