Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | alpha,alpha-Dicyclopropyl-4-Methylbenzenemethanol |
|---|---|
| Synonyms | Alpha,Alpha-Dicyclopropyl-4-Methylbenzyl Alcohol; Zinc02170011 |
| Molecular Structure |  |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 |
| CAS Registry Number | 71172-47-9 |
| EINECS | 275-233-6 |
| SMILES | C1=CC(=CC=C1C(C2CC2)(C3CC3)O)C |
| InChI | 1S/C14H18O/c1-10-2-4-11(5-3-10)14(15,12-6-7-12)13-8-9-13/h2-5,12-13,15H,6-9H2,1H3 |
| InChIKey | ZLDYBMZGEIJXHG-UHFFFAOYSA-N |
| Density | 1.176g/cm3 (Cal.) |
|---|---|
| Boiling point | 327.678°C at 760 mmHg (Cal.) |
| Flash point | 140.135°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for alpha,alpha-Dicyclopropyl-4-Methylbenzenemethanol |