| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
![]() |
+1 (201) 478-8534 | |||
![]() |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Classification | Analytical chemistry >> Standard >> Food and beverage standards |
|---|---|
| Name | Linalyl Anthranilate |
| Synonyms | (1,5-Dimethyl-1-Vinyl-Hex-4-Enyl) 2-Aminobenzoate; 2-Aminobenzoic Acid (1,5-Dimethyl-1-Vinylhex-4-Enyl) Ester; 2-Aminobenzoic Acid (1,5-Dimethyl-1-Vinyl-Hex-4-Enyl) Ester |
| Molecular Structure | ![]() |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.37 |
| CAS Registry Number | 7149-26-0 |
| EINECS | 230-472-5 |
| FEMA | 2637 |
| SMILES | C1=CC=CC(=C1C(OC(CCC=C(C)C)(C=C)C)=O)N |
| InChI | 1S/C17H23NO2/c1-5-17(4,12-8-9-13(2)3)20-16(19)14-10-6-7-11-15(14)18/h5-7,9-11H,1,8,12,18H2,2-4H3 |
| InChIKey | WHIJSULEEDNKPD-UHFFFAOYSA-N |
| Density | 1.025g/cm3 (Cal.) |
|---|---|
| Boiling point | 370-371°C (Expl.) |
| 403.157°C at 760 mmHg (Cal.) | |
| Flash point | 235.685°C (Cal.) |
| Refractive index | 1.516-1.522 (Expl.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Linalyl Anthranilate |