Online Database of Chemicals from Around the World
|
CAS#: 71975-60-5 Product: Trifluoro-10H-Phenothiazine No suppilers available for the product. |
| Name | Trifluoro-10H-Phenothiazine |
|---|---|
| Synonyms | Trifluoro-10H-Phenothiazine |
| Molecular Structure |  |
| Molecular Formula | C12H6F3NS |
| Molecular Weight | 253.24 |
| CAS Registry Number | 71975-60-5 |
| EINECS | 276-248-0 |
| SMILES | C1=C(F)C(=C(F)C2=C1SC3=C(N2)C=CC=C3)F |
| InChI | 1S/C12H6F3NS/c13-6-5-9-12(11(15)10(6)14)16-7-3-1-2-4-8(7)17-9/h1-5,16H |
| InChIKey | ILAKSAOPWGMEMJ-UHFFFAOYSA-N |
| Density | 1.454g/cm3 (Cal.) |
|---|---|
| Boiling point | 336.385°C at 760 mmHg (Cal.) |
| Flash point | 157.241°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Trifluoro-10H-Phenothiazine |