Online Database of Chemicals from Around the World
|
CAS#: 7218-24-8 Product: N-(Chloroacetyl)Phthalimide No suppilers available for the product. |
| Name | N-(Chloroacetyl)Phthalimide |
|---|---|
| Synonyms | 2-(2-Chloroacetyl)Isoindoline-1,3-Dione; 2-(2-Chloro-1-Oxoethyl)Isoindoline-1,3-Dione; 2-(2-Chloroacetyl)Isoindoline-1,3-Quinone |
| Molecular Structure |  |
| Molecular Formula | C10H6ClNO3 |
| Molecular Weight | 223.62 |
| CAS Registry Number | 7218-24-8 |
| EINECS | 230-610-4 |
| SMILES | C1=CC=CC2=C1C(N(C2=O)C(CCl)=O)=O |
| InChI | 1S/C10H6ClNO3/c11-5-8(13)12-9(14)6-3-1-2-4-7(6)10(12)15/h1-4H,5H2 |
| InChIKey | MHOLXDZIPDVQRT-UHFFFAOYSA-N |
| Density | 1.54g/cm3 (Cal.) |
|---|---|
| Boiling point | 378.733°C at 760 mmHg (Cal.) |
| Flash point | 182.851°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Chloroacetyl)Phthalimide |