Online Database of Chemicals from Around the World
|
CAS#: 722-23-6 Product: 3'-Methylazobenzene-4-Amine No suppilers available for the product. |
| Name | 3'-Methylazobenzene-4-Amine |
|---|---|
| Synonyms | 4-(3-Methylphenyl)Azoaniline; [4-(3-Methylphenyl)Azophenyl]Amine; 3'-Methyl-4-Aminoazobenzene |
| Molecular Structure |  |
| Molecular Formula | C13H13N3 |
| Molecular Weight | 211.27 |
| CAS Registry Number | 722-23-6 |
| SMILES | C2=CC=C(N=NC1=CC=C(C=C1)N)C=C2C |
| InChI | 1S/C13H13N3/c1-10-3-2-4-13(9-10)16-15-12-7-5-11(14)6-8-12/h2-9H,14H2,1H3 |
| InChIKey | KCOITMFSLVDOGO-UHFFFAOYSA-N |
| Density | 1.111g/cm3 (Cal.) |
|---|---|
| Boiling point | 388.391°C at 760 mmHg (Cal.) |
| Flash point | 188.692°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3'-Methylazobenzene-4-Amine |