Online Database of Chemicals from Around the World
| ChemBridge Corporation | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (858) 451-7400 | |||
 |
sales@chembridge.com | |||
| Chemical manufacturer | ||||
| Name | 4-Methylazobenzene |
|---|---|
| Synonyms | (4-Methylphenyl)-Phenyl-Diazene; Cbdive_003176; Azobenzene, 4-Methyl- |
| Molecular Structure |  |
| Molecular Formula | C13H12N2 |
| Molecular Weight | 196.25 |
| CAS Registry Number | 949-87-1 (6720-39-4) |
| EINECS | 213-444-7 |
| SMILES | C2=C(N=NC1=CC=CC=C1)C=CC(=C2)C |
| InChI | 1S/C13H12N2/c1-11-7-9-13(10-8-11)15-14-12-5-3-2-4-6-12/h2-10H,1H3 |
| InChIKey | GIJSVMOPNUOZBC-UHFFFAOYSA-N |
| Density | 1.015g/cm3 (Cal.) |
|---|---|
| Boiling point | 312.58°C at 760 mmHg (Cal.) |
| Flash point | 134.85°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Methylazobenzene |