Online Database of Chemicals from Around the World
|
CAS#: 72918-29-7 Product: 4,8-Diamino-2,3,6-Tribromonaphthalene-1,5-Dione No suppilers available for the product. |
| Name | 4,8-Diamino-2,3,6-Tribromonaphthalene-1,5-Dione |
|---|---|
| Synonyms | 4,8-Diamino-2,3,6-Tribromo-Naphthalene-1,5-Dione; 4,8-Diamino-2,3,6-Tribromo-Naphthalene-1,5-Quinone; 1(4H)-Naphthalenone, 8-Amino-2,3,6-Tribromo-5-Hydroxy-4-Imino- |
| Molecular Structure |  |
| Molecular Formula | C10H5Br3N2O2 |
| Molecular Weight | 424.87 |
| CAS Registry Number | 72918-29-7 |
| SMILES | O=C2C1=C(N)C=C(Br)C(=O)C1=C(N)C(=C2Br)Br |
| InChI | 1S/C10H5Br3N2O2/c11-2-1-3(14)4-5(9(2)16)8(15)6(12)7(13)10(4)17/h1H,14-15H2 |
| InChIKey | AAHIUXOQRCPDBD-UHFFFAOYSA-N |
| Density | 2.49g/cm3 (Cal.) |
|---|---|
| Boiling point | 310.626°C at 760 mmHg (Cal.) |
| Flash point | 141.662°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4,8-Diamino-2,3,6-Tribromonaphthalene-1,5-Dione |