Online Database of Chemicals from Around the World
|
CAS#: 94158-81-3 Product: 1,4-Diamino-2,3,5-Trichloro-8-Hydroxyanthraquinone No suppilers available for the product. |
| Name | 1,4-Diamino-2,3,5-Trichloro-8-Hydroxyanthraquinone |
|---|---|
| Synonyms | 1,4-Diamino-2,3,5-Trichloro-8-Hydroxy-Anthracene-9,10-Dione; 1,4-Diamino-2,3,5-Trichloro-8-Hydroxy-9,10-Anthraquinone; 1,4-Diamino-2,3,5-Trichloro-8-Hydroxyanthraquinone |
| Molecular Structure |  |
| Molecular Formula | C14H7Cl3N2O3 |
| Molecular Weight | 357.58 |
| CAS Registry Number | 94158-81-3 |
| EINECS | 303-155-5 |
| SMILES | C1=CC(=C2C(=C1O)C(=O)C3=C(C2=O)C(=C(Cl)C(=C3N)Cl)N)Cl |
| InChI | 1S/C14H7Cl3N2O3/c15-3-1-2-4(20)6-5(3)13(21)7-8(14(6)22)12(19)10(17)9(16)11(7)18/h1-2,20H,18-19H2 |
| InChIKey | ZXMUCTGIHDSPBT-UHFFFAOYSA-N |
| Density | 1.807g/cm3 (Cal.) |
|---|---|
| Boiling point | 690.539°C at 760 mmHg (Cal.) |
| Flash point | 371.425°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,4-Diamino-2,3,5-Trichloro-8-Hydroxyanthraquinone |