|
CAS#: 730-23-4 Product: 4-[(3-Nitrophenyl)Azo]Aniline No suppilers available for the product. |
| Name | 4-[(3-Nitrophenyl)Azo]Aniline |
|---|---|
| Synonyms | 4-(3-Nitrophenyl)Azoaniline; [4-(3-Nitrophenyl)Azophenyl]Amine; Benzenamine, 4-((3-Nitrophenyl)Azo)- |
| Molecular Structure | ![]() |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 |
| CAS Registry Number | 730-23-4 |
| EINECS | 211-983-2 |
| SMILES | C1=C(C=CC(=C1)N=NC2=CC(=CC=C2)[N+]([O-])=O)N |
| InChI | 1S/C12H10N4O2/c13-9-4-6-10(7-5-9)14-15-11-2-1-3-12(8-11)16(17)18/h1-8H,13H2 |
| InChIKey | MDMDJAOEKAAIGH-UHFFFAOYSA-N |
| Density | 1.343g/cm3 (Cal.) |
|---|---|
| Boiling point | 442.895°C at 760 mmHg (Cal.) |
| Flash point | 221.655°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-[(3-Nitrophenyl)Azo]Aniline |