Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-(4-Nitrophenylazo)Catechol |
|---|---|
| Synonyms | 4-[N'-(4-Nitrophenyl)Hydrazino]-1,2-Benzoquinone; 4-[N'-(4-Nitrophenyl)Hydrazino]-O-Benzoquinone; Nsc75879 |
| Molecular Structure |  |
| Molecular Formula | C12H9N3O4 |
| Molecular Weight | 259.22 |
| CAS Registry Number | 843-33-4 |
| EINECS | 212-676-6 |
| SMILES | C2=C(NNC1=CC(=O)C(=O)C=C1)C=CC(=C2)[N+]([O-])=O |
| InChI | 1S/C12H9N3O4/c16-11-6-3-9(7-12(11)17)14-13-8-1-4-10(5-2-8)15(18)19/h1-7,13-14H |
| InChIKey | MKFXYEBJVGGEKE-UHFFFAOYSA-N |
| Density | 1.46g/cm3 (Cal.) |
|---|---|
| Boiling point | 351.765°C at 760 mmHg (Cal.) |
| Flash point | 166.542°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-(4-Nitrophenylazo)Catechol |