Online Database of Chemicals from Around the World
|
CAS#: 73526-35-9 Product: 1,1,3,3-Tetramethyl-6-(2,4,4-Trimethylpentan-2-Yl)-2H-Inden-5-Ol No suppilers available for the product. |
| Name | 1,1,3,3-Tetramethyl-6-(2,4,4-Trimethylpentan-2-Yl)-2H-Inden-5-Ol |
|---|---|
| Synonyms | 1,1,3,3-Tetramethyl-6-(1,1,3,3-Tetramethylbutyl)Indan-5-Ol; 1,1,3,3-Tetramethyl-6-(1,1,3,3-Tetramethylbutyl)-5-Indanol |
| Molecular Structure |  |
| Molecular Formula | C21H34O |
| Molecular Weight | 302.50 |
| CAS Registry Number | 73526-35-9 |
| EINECS | 277-526-4 |
| SMILES | C1=C(O)C(=CC2=C1C(CC2(C)C)(C)C)C(CC(C)(C)C)(C)C |
| InChI | 1S/C21H34O/c1-18(2,3)12-19(4,5)16-10-14-15(11-17(16)22)21(8,9)13-20(14,6)7/h10-11,22H,12-13H2,1-9H3 |
| InChIKey | UCPLXKGSKHNLFC-UHFFFAOYSA-N |
| Density | 0.926g/cm3 (Cal.) |
|---|---|
| Boiling point | 367.536°C at 760 mmHg (Cal.) |
| Flash point | 165.737°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,3,3-Tetramethyl-6-(2,4,4-Trimethylpentan-2-Yl)-2H-Inden-5-Ol |