Online Database of Chemicals from Around the World
|
CAS#: 73928-01-5 Product: 3-Chloro-4-Stilbenamine No suppilers available for the product. |
| Name | 3-Chloro-4-Stilbenamine |
|---|---|
| Synonyms | 2-Chloro-4-[(E)-2-Phenylvinyl]Aniline; [2-Chloro-4-[(E)-2-Phenylvinyl]Phenyl]Amine; 3-Chloro-4-Aminostilbene |
| Molecular Structure |  |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 |
| CAS Registry Number | 73928-01-5 |
| SMILES | C1=C(C(=CC=C1\C=C\C2=CC=CC=C2)N)Cl |
| InChI | 1S/C14H12ClN/c15-13-10-12(8-9-14(13)16)7-6-11-4-2-1-3-5-11/h1-10H,16H2/b7-6+ |
| InChIKey | DPVYMTGJFBIUHN-VOTSOKGWSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.063°C at 760 mmHg (Cal.) |
| Flash point | 184.865°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Chloro-4-Stilbenamine |