Online Database of Chemicals from Around the World
|
CAS#: 7570-36-7 Product: 4'-Chloro-4-stilbenamine No suppilers available for the product. |
| Name | 4'-Chloro-4-stilbenamine |
|---|---|
| Synonyms | 4-[(E)-2-(4-Chlorophenyl)Vinyl]Aniline; [4-[(E)-2-(4-Chlorophenyl)Vinyl]Phenyl]Amine; 4'-Chloro-4-Stilbenamine |
| Molecular Structure |  |
| Molecular Formula | C14H12ClN |
| Molecular Weight | 229.71 |
| CAS Registry Number | 7570-36-7 |
| SMILES | C1=CC(=CC=C1N)\C=C\C2=CC=C(C=C2)Cl |
| InChI | 1S/C14H12ClN/c15-13-7-3-11(4-8-13)1-2-12-5-9-14(16)10-6-12/h1-10H,16H2/b2-1+ |
| InChIKey | XPIHDAPOGFAZLY-OWOJBTEDSA-N |
| Density | 1.229g/cm3 (Cal.) |
|---|---|
| Boiling point | 397.194°C at 760 mmHg (Cal.) |
| Flash point | 194.016°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Chloro-4-stilbenamine |