Online Database of Chemicals from Around the World
|
CAS#: 74038-74-7 Product: 3-Fluoro-2'-(3-Fluorobenzoyl)Benzohydrazide No suppilers available for the product. |
| Name | 3-Fluoro-2'-(3-Fluorobenzoyl)Benzohydrazide |
|---|---|
| Synonyms | 3-Fluoro-N'-[(3-Fluorophenyl)-Oxomethyl]Benzohydrazide; 3-Fluoro-N'-(3-Fluorophenyl)Carbonyl-Benzohydrazide |
| Molecular Structure |  |
| Molecular Formula | C14H10F2N2O2 |
| Molecular Weight | 276.24 |
| CAS Registry Number | 74038-74-7 |
| EINECS | 277-677-6 |
| SMILES | C1=C(C=CC=C1C(NNC(C2=CC(=CC=C2)F)=O)=O)F |
| InChI | 1S/C14H10F2N2O2/c15-11-5-1-3-9(7-11)13(19)17-18-14(20)10-4-2-6-12(16)8-10/h1-8H,(H,17,19)(H,18,20) |
| InChIKey | DJCSGSALPRONGK-UHFFFAOYSA-N |
| Density | 1.338g/cm3 (Cal.) |
|---|---|
| Boiling point | 507.277°C at 760 mmHg (Cal.) |
| Flash point | 260.592°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 3-Fluoro-2'-(3-Fluorobenzoyl)Benzohydrazide |