Online Database of Chemicals from Around the World
|
CAS#: 74039-14-8 Product: 1,2,3,4,7,7-Hexachloronorborn-5-Ene-2,3-Dicarboxamide No suppilers available for the product. |
| Name | 1,2,3,4,7,7-Hexachloronorborn-5-Ene-2,3-Dicarboxamide |
|---|---|
| Synonyms | 5-Norbornene-2,3-Dicarboxamide, 1,2,3,4,7,7-Hexachloro-; 1,2,3,4,7,7-Hexachloro-5-Norbornene-2,3-Dicarboxamide |
| Molecular Structure |  |
| Molecular Formula | C9H6Cl6N2O2 |
| Molecular Weight | 386.88 |
| CAS Registry Number | 74039-14-8 |
| SMILES | O=C(C1(C2(C=CC(C1(C(=O)N)Cl)(C2(Cl)Cl)Cl)Cl)Cl)N |
| InChI | 1S/C9H6Cl6N2O2/c10-5-1-2-6(11,9(5,14)15)8(13,4(17)19)7(5,12)3(16)18/h1-2H,(H2,16,18)(H2,17,19) |
| InChIKey | NUWGHXFZRLXKOI-UHFFFAOYSA-N |
| Density | 1.878g/cm3 (Cal.) |
|---|---|
| Boiling point | 588.699°C at 760 mmHg (Cal.) |
| Flash point | 309.834°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,2,3,4,7,7-Hexachloronorborn-5-Ene-2,3-Dicarboxamide |