Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 1,1,1,3,8,9-Hexachlorononane |
|---|---|
| Synonyms | 1,1,1,3,8,9-Hexachlornonan; 1,1,1,3,8,9-Hexachlorononane; 1,1,1,3,8,9-Hexachlorononane |
| Molecular Structure |  |
| Molecular Formula | C9H14Cl6 |
| Molecular Weight | 334.93 |
| CAS Registry Number | 865306-21-4 |
| SMILES | C(CCC(CCl)Cl)CC(CC(Cl)(Cl)Cl)Cl |
| InChI | 1S/C9H14Cl6/c10-6-8(12)4-2-1-3-7(11)5-9(13,14)15/h7-8H,1-6H2 |
| InChIKey | FLPYBWOIOHZULG-UHFFFAOYSA-N |
| Density | 1.4±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 404.0±13.0°C at 760 mmHg (Cal.) |
| Flash point | 197.6±17.2°C (Cal.) |
| Refractive index | 1.503 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1,1,3,8,9-Hexachlorononane |