Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 4-Iodoaniline Hydrochloride |
|---|---|
| Synonyms | (4-Iodophenyl)Amine Hydrochloride; 4-Iodoanilinium Chloride |
| Molecular Structure |  |
| Molecular Formula | C6H7ClIN |
| Molecular Weight | 255.49 |
| CAS Registry Number | 74367-81-0 |
| EINECS | 277-842-2 |
| SMILES | [H+].C1=C(N)C=CC(=C1)I.[Cl-] |
| InChI | 1S/C6H6IN.ClH/c7-5-1-3-6(8)4-2-5;/h1-4H,8H2;1H |
| InChIKey | XEQNZUYMGIGJQT-UHFFFAOYSA-N |
| Boiling point | 268.7°C at 760 mmHg (Cal.) |
|---|---|
| Flash point | 116.3°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for 4-Iodoaniline Hydrochloride |