Online Database of Chemicals from Around the World
|
CAS#: 81530-23-6 Product: 3-Iodo-4-Aminophentermine No suppilers available for the product. |
| Name | 3-Iodo-4-Aminophentermine |
|---|---|
| Synonyms | 4-(2-Amino-2-Methyl-Propyl)-2-Iodo-Aniline; [2-(4-Amino-3-Iodo-Phenyl)-1,1-Dimethyl-Ethyl]Amine; 4-Amino-3-Iodo-Alpha,Alpha-Dimethylbenzeneethanamine |
| Molecular Structure |  |
| Molecular Formula | C10H15IN2 |
| Molecular Weight | 290.15 |
| CAS Registry Number | 81530-23-6 |
| SMILES | C1=C(C(=CC=C1CC(N)(C)C)N)I |
| InChI | 1S/C10H15IN2/c1-10(2,13)6-7-3-4-9(12)8(11)5-7/h3-5H,6,12-13H2,1-2H3 |
| InChIKey | SJTPTIAXCKYNNF-UHFFFAOYSA-N |
| Density | 1.582g/cm3 (Cal.) |
|---|---|
| Boiling point | 348.119°C at 760 mmHg (Cal.) |
| Flash point | 164.337°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3-Iodo-4-Aminophentermine |