Online Database of Chemicals from Around the World
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (631) 485-4226 | |||
 |
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Matrix Scientific Inc. | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (803) 788-9494 | |||
|
sales@matrixscientific.com | |||
| Chemical manufacturer | ||||
| Name | Diethyl 2-(4-Chlorophenyl)-1,1-Cyclopropanedicarboxylate |
|---|---|
| Synonyms | (2S)-2-(4-Chlorophenyl)Cyclopropane-1,1-Dicarboxylic Acid Diethyl Ester; Zinc00167444 |
| Molecular Structure |  |
| Molecular Formula | C15H17ClO4 |
| Molecular Weight | 296.75 |
| CAS Registry Number | 74444-83-0 |
| SMILES | [C@@H]1(C(C1)(C(OCC)=O)C(OCC)=O)C2=CC=C(Cl)C=C2 |
| InChI | 1S/C15H17ClO4/c1-3-19-13(17)15(14(18)20-4-2)9-12(15)10-5-7-11(16)8-6-10/h5-8,12H,3-4,9H2,1-2H3/t12-/m0/s1 |
| InChIKey | WHGBMFXPDCARTE-LBPRGKRZSA-N |
| Density | 1.257g/cm3 (Cal.) |
|---|---|
| Boiling point | 350.313°C at 760 mmHg (Cal.) |
| Flash point | 126.859°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Diethyl 2-(4-Chlorophenyl)-1,1-Cyclopropanedicarboxylate |