Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-Amino-9H-fluoren-1-ol |
|---|---|
| Molecular Structure |  |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.23 |
| CAS Registry Number | 748186-92-7 |
| SMILES | C1C2=CC=CC=C2C3=C(C=CC(=C31)O)N |
| InChI | 1S/C13H11NO/c14-11-5-6-12(15)10-7-8-3-1-2-4-9(8)13(10)11/h1-6,15H,7,14H2 |
| InChIKey | HBWKSYOLGPSNHT-UHFFFAOYSA-N |
| Density | 1.3±0.1g/cm3 (Cal.) |
|---|---|
| Boiling point | 435.6±45.0°C at 760 mmHg (Cal.) |
| Flash point | 217.2±28.7°C (Cal.) |
| Refractive index | 1.737 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-Amino-9H-fluoren-1-ol |