Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2-Hydroxyethyl 5-oxo-L-prolinate |
|---|---|
| Synonyms | (S)-2-hydroxyethyl 5-oxopyrrolidine-2-carboxylate |
| Molecular Structure |  |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 |
| CAS Registry Number | 7518-82-3 |
| SMILES | C1CC(=O)N[C@@H]1C(=O)OCCO |
| InChI | 1S/C7H11NO4/c9-3-4-12-7(11)5-1-2-6(10)8-5/h5,9H,1-4H2,(H,8,10)/t5-/m0/s1 |
| InChIKey | QOUCIKNDMWJHHB-YFKPBYRVSA-N |
| Density | 1.303g/cm3 (Cal.) |
|---|---|
| Boiling point | 449.613°C at 760 mmHg (Cal.) |
| Flash point | 225.718°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-Hydroxyethyl 5-oxo-L-prolinate |