Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 4-(2-Aminoethyl)-1,2-naphthalenediol |
|---|---|
| Synonyms | 4-(2-aminoethyl)naphthalene-1,2-diol |
| Molecular Structure |  |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.24 |
| CAS Registry Number | 753394-43-3 |
| SMILES | c1ccc2c(c1)c(cc(c2O)O)CCN |
| InChI | 1S/C12H13NO2/c13-6-5-8-7-11(14)12(15)10-4-2-1-3-9(8)10/h1-4,7,14-15H,5-6,13H2 |
| InChIKey | YUZXJJQFISVSNU-UHFFFAOYSA-N |
| Density | 1.295g/cm3 (Cal.) |
|---|---|
| Boiling point | 441.125°C at 760 mmHg (Cal.) |
| Flash point | 220.585°C (Cal.) |
| Refractive index | 1.704 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4-(2-Aminoethyl)-1,2-naphthalenediol |