Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | N-Carbamoyl-3-fluoro-L-alanine |
|---|---|
| Synonyms | (R)-3-fluoro-2-ureidopropanoic acid |
| Molecular Structure |  |
| Molecular Formula | C4H7FN2O3 |
| Molecular Weight | 150.11 |
| CAS Registry Number | 756792-46-8 |
| SMILES | C([C@@H](C(=O)O)NC(=O)N)F |
| InChI | 1S/C4H7FN2O3/c5-1-2(3(8)9)7-4(6)10/h2H,1H2,(H,8,9)(H3,6,7,10)/t2-/m0/s1 |
| InChIKey | FYTNLCJHUUXQOX-REOHCLBHSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 333.831°C at 760 mmHg (Cal.) |
| Flash point | 155.696°C (Cal.) |
| Refractive index | 1.474 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-Carbamoyl-3-fluoro-L-alanine |