Online Database of Chemicals from Around the World
| Achemica | Switzerland | Inquire | ||
|---|---|---|---|---|
 |
+41 (24) 466-2929 | |||
 |
contact@achemica.com | |||
| Chemical manufacturer since 2010 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 2-[(4-Isocyanatophenyl)Thio]Phenyl Isocyanate |
|---|---|
| Synonyms | 1-Isocyanato-2-(4-Isocyanatophenyl)Sulfanyl-Benzene; 1-Isocyanato-2-[(4-Isocyanatophenyl)Thio]Benzene; Benzene, 1-Isocyanato-2-((4-Isocyanatophenyl)Thio)- |
| Molecular Structure | ![CAS#: 75790-87-3， 2-[(4-Isocyanatophenyl)Thio]Phenyl Isocyanate](/moreStructures/75790-87-3.gif) |
| Molecular Formula | C14H8N2O2S |
| Molecular Weight | 268.29 |
| CAS Registry Number | 75790-87-3 |
| EINECS | 278-313-9 |
| SMILES | O=C=NC2=C(SC1=CC=C(C=C1)N=C=O)C=CC=C2 |
| InChI | 1S/C14H8N2O2S/c17-9-15-11-5-7-12(8-6-11)19-14-4-2-1-3-13(14)16-10-18/h1-8H |
| InChIKey | QEROATAKCLNWHV-UHFFFAOYSA-N |
| Density | 1.222g/cm3 (Cal.) |
|---|---|
| Boiling point | 382.772°C at 760 mmHg (Cal.) |
| Flash point | 185.294°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-[(4-Isocyanatophenyl)Thio]Phenyl Isocyanate |