|
CAS#: 906352-73-6 Product: 2-(4-Isocyanatophenyl)-5-(trifluoromethyl)pyridine No suppilers available for the product. |
| Name | 2-(4-Isocyanatophenyl)-5-(trifluoromethyl)pyridine |
|---|---|
| Synonyms | 2-(4-isocyanatophenyl)-5-(trifluoromethyl)pyridine; 4-[5-(trifluoromethyl)-2-pyridyl]benzenisocyanate |
| Molecular Structure | ![]() |
| Molecular Formula | C13H7F3N2O |
| Molecular Weight | 264.20 |
| CAS Registry Number | 906352-73-6 |
| SMILES | c1cc(ccc1c2ccc(cn2)C(F)(F)F)N=C=O |
| InChI | 1S/C13H7F3N2O/c14-13(15,16)10-3-6-12(17-7-10)9-1-4-11(5-2-9)18-8-19/h1-7H |
| InChIKey | GFEVPIXAPFROGH-UHFFFAOYSA-N |
| Density | 1.285g/cm3 (Cal.) |
|---|---|
| Boiling point | 318.373°C at 760 mmHg (Cal.) |
| Flash point | 146.347°C (Cal.) |
| Refractive index | 1.539 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(4-Isocyanatophenyl)-5-(trifluoromethyl)pyridine |