Online Database of Chemicals from Around the World
|
CAS#: 76843-75-9 Product: 3,7-diphenyl-1,5-Dithia-2,4,6,8-tetrazocine No suppilers available for the product. |
| Name | 3,7-diphenyl-1,5-Dithia-2,4,6,8-tetrazocine |
|---|---|
| Synonyms | 3,7-Di(Phenyl)-1$L^{4},5-Dithia-2,4,6,8-Tetrazacycloocta-1,3,6,8-Tetraene; (6E)-3,7-Di(Phenyl)-1$L^{4},5-Dithia-2,4,6,8-Tetrazacycloocta-1,3,6,8-Tetraene; (3Z,6Z)-3,7-Di(Phenyl)-1$L^{4},5-Dithia-2,4,6,8-Tetrazacycloocta-1,3,6,8-Tetraene |
| Molecular Structure |  |
| Molecular Formula | C14H10N4S2 |
| Molecular Weight | 298.38 |
| CAS Registry Number | 76843-75-9 |
| SMILES | N1=[S]=NC(=NSN=C1C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | 1S/C14H10N4S2/c1-3-7-11(8-4-1)13-15-19-17-14(18-20-16-13)12-9-5-2-6-10-12/h1-10H |
| InChIKey | DGZKXDKRIYGMML-UHFFFAOYSA-N |
| Density | 1.354g/cm3 (Cal.) |
|---|---|
| Boiling point | 426.257°C at 760 mmHg (Cal.) |
| Flash point | 211.593°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,7-diphenyl-1,5-Dithia-2,4,6,8-tetrazocine |