Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | (3,3,3-Trifluoro-2-oxopropylidene)malononitrile |
|---|---|
| Synonyms | 2-(3,3,3-trifluoro-2-oxopropylidene)malononitrile |
| Molecular Structure |  |
| Molecular Formula | C6HF3N2O |
| Molecular Weight | 174.08 |
| CAS Registry Number | 771570-04-8 |
| SMILES | C(=C(C#N)C#N)C(=O)C(F)(F)F |
| InChI | 1S/C6HF3N2O/c7-6(8,9)5(12)1-4(2-10)3-11/h1H |
| InChIKey | HABPBCIEPPUAMC-UHFFFAOYSA-N |
| Density | 1.435g/cm3 (Cal.) |
|---|---|
| Boiling point | 159.561°C at 760 mmHg (Cal.) |
| Flash point | 50.301°C (Cal.) |
| Refractive index | 1.41 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for (3,3,3-Trifluoro-2-oxopropylidene)malononitrile |