Online Database of Chemicals from Around the World
|
CAS#: 78751-58-3 Product: Pyren-2-Ol No suppilers available for the product. |
| Name | Pyren-2-Ol |
|---|---|
| Synonyms | 2-Pyrenol; C0861; 2-Hydroxypyrene |
| Molecular Structure |  |
| Molecular Formula | C16H10O |
| Molecular Weight | 218.25 |
| CAS Registry Number | 78751-58-3 |
| SMILES | C2=CC1=CC=CC4=C1C3=C2C=C(O)C=C3C=C4 |
| InChI | 1S/C16H10O/c17-14-8-12-6-4-10-2-1-3-11-5-7-13(9-14)16(12)15(10)11/h1-9,17H |
| InChIKey | NKFFJDXMGAZKEQ-UHFFFAOYSA-N |
| Density | 1.361g/cm3 (Cal.) |
|---|---|
| Boiling point | 437.407°C at 760 mmHg (Cal.) |
| Flash point | 212.987°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Pyren-2-Ol |