Online Database of Chemicals from Around the World
|
CAS#: 1732-14-5 Product: N-(Pyren-2-Yl)Acetamide No suppilers available for the product. |
| Name | N-(Pyren-2-Yl)Acetamide |
|---|---|
| Synonyms | N-(2-Pyrenyl)Acetamide; N-Pyren-2-Ylethanamide; 2-Acetylaminopyrene |
| Molecular Structure |  |
| Molecular Formula | C18H13NO |
| Molecular Weight | 259.31 |
| CAS Registry Number | 1732-14-5 |
| SMILES | C1=C4C2=C(C=C1NC(=O)C)C=CC3=CC=CC(=C23)C=C4 |
| InChI | 1S/C18H13NO/c1-11(20)19-16-9-14-7-5-12-3-2-4-13-6-8-15(10-16)18(14)17(12)13/h2-10H,1H3,(H,19,20) |
| InChIKey | FODXCWHSOLTOJH-UHFFFAOYSA-N |
| Density | 1.329g/cm3 (Cal.) |
|---|---|
| Boiling point | 535.732°C at 760 mmHg (Cal.) |
| Flash point | 319.908°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for N-(Pyren-2-Yl)Acetamide |