Online Database of Chemicals from Around the World
|
CAS#: 79951-01-2 Product: Maleimidomethyl-3-Maleimido Propionate No suppilers available for the product. |
| Name | Maleimidomethyl-3-Maleimido Propionate |
|---|---|
| Synonyms | 3-(2,5-Dioxo-1-Pyrrolyl)Propanoic Acid (2,5-Dioxo-1-Pyrrolyl)Methyl Ester; 3-Maleimidopropionic Acid Maleimidomethyl Ester; 1H-Pyrrole-1-Propanoic Acid, 2,5-Dihydro-2,5-Dioxo-, (2,5-Dihydro-2,5-Dioxo-1H-Pyrrol-1-Yl)Methyl Ester |
| Molecular Structure |  |
| Molecular Formula | C12H10N2O6 |
| Molecular Weight | 278.22 |
| CAS Registry Number | 79951-01-2 |
| SMILES | C(C(=O)OCN1C(C=CC1=O)=O)CN2C(C=CC2=O)=O |
| InChI | 1S/C12H10N2O6/c15-8-1-2-9(16)13(8)6-5-12(19)20-7-14-10(17)3-4-11(14)18/h1-4H,5-7H2 |
| InChIKey | LPXCLYYETHSUGN-UHFFFAOYSA-N |
| Density | 1.527g/cm3 (Cal.) |
|---|---|
| Boiling point | 499.812°C at 760 mmHg (Cal.) |
| Flash point | 256.077°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Maleimidomethyl-3-Maleimido Propionate |