Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Name | 2-(3,4-Dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |
|---|---|
| Synonyms | 2-(3,4-Dimethoxyphenyl)-4,6-Bis(Trichloromethyl)-S-Triazine |
| Molecular Structure |  |
| Molecular Formula | C13H9Cl6N3O2 |
| Molecular Weight | 451.95 |
| CAS Registry Number | 80050-87-9 |
| EINECS | 279-382-8 |
| SMILES | C2=C(C1=NC(=NC(=N1)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)C=CC(=C2OC)OC |
| InChI | 1S/C13H9Cl6N3O2/c1-23-7-4-3-6(5-8(7)24-2)9-20-10(12(14,15)16)22-11(21-9)13(17,18)19/h3-5H,1-2H3 |
| InChIKey | RLYHOBWTMJVPGB-UHFFFAOYSA-N |
| Density | 1.586g/cm3 (Cal.) |
|---|---|
| Boiling point | 487.258°C at 760 mmHg (Cal.) |
| Flash point | 248.485°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2-(3,4-Dimethoxyphenyl)-4,6-bis(trichloromethyl)-1,3,5-triazine |