Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,4-Diisopropylidene-6,6-dimethylcycloheptanone |
|---|---|
| Synonyms | 6,6-dimethyl-2,4-di(propan-2-ylidene)cycloheptanone |
| Molecular Structure |  |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.35 |
| CAS Registry Number | 801299-69-4 |
| SMILES | O=C1\C(=C(/C)C)CC(=C(\C)C)\CC(C)(C)C1 |
| InChI | 1S/C15H24O/c1-10(2)12-7-13(11(3)4)14(16)9-15(5,6)8-12/h7-9H2,1-6H3 |
| InChIKey | XXZKBJMSLOFTKW-UHFFFAOYSA-N |
| Density | 0.907g/cm3 (Cal.) |
|---|---|
| Boiling point | 306.046°C at 760 mmHg (Cal.) |
| Flash point | 140.434°C (Cal.) |
| Refractive index | 1.478 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diisopropylidene-6,6-dimethylcycloheptanone |