Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 2,4-Diisopropylidenecyclopentanone |
|---|---|
| Synonyms | 2,4-di(propan-2-ylidene)cyclopentanone |
| Molecular Structure |  |
| Molecular Formula | C11H16O |
| Molecular Weight | 164.24 |
| CAS Registry Number | 96666-39-6 |
| SMILES | CC(=C1CC(=C(C)C)C(=O)C1)C |
| InChI | 1S/C11H16O/c1-7(2)9-5-10(8(3)4)11(12)6-9/h5-6H2,1-4H3 |
| InChIKey | OEINZRAZEDSHQK-UHFFFAOYSA-N |
| Density | 0.972g/cm3 (Cal.) |
|---|---|
| Boiling point | 250.295°C at 760 mmHg (Cal.) |
| Flash point | 103.195°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 2,4-Diisopropylidenecyclopentanone |