Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 1,1-dimethyl-3-phenyl-isoindole |
|---|---|
| Synonyms | 1,1-dimethyl-3-phenyl-1H-isoindole |
| Molecular Structure |  |
| Molecular Formula | C16H15N |
| Molecular Weight | 221.30 |
| CAS Registry Number | 809283-62-3 |
| SMILES | CC2(C)/N=C(\c1ccccc12)c3ccccc3 |
| InChI | 1S/C16H15N/c1-16(2)14-11-7-6-10-13(14)15(17-16)12-8-4-3-5-9-12/h3-11H,1-2H3 |
| InChIKey | MAHJPPMMSSUJMD-UHFFFAOYSA-N |
| Density | 1.039g/cm3 (Cal.) |
|---|---|
| Boiling point | 315.851°C at 760 mmHg (Cal.) |
| Flash point | 136.846°C (Cal.) |
| Refractive index | 1.589 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,1-dimethyl-3-phenyl-isoindole |