Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| BOC Sciences | USA | Inquire | ||
|---|---|---|---|---|
|
+1 (631) 485-4226 | |||
|
info@bocsci.com | |||
 |
Skype Chat | |||
| Chemical distributor | ||||
| chemBlink standard supplier since 2010 | ||||
| Name | 9H-Fluoren-9-ylmethyl 3-amino-1-pyrrolidinecarboxylate |
|---|---|
| Synonyms | 1-N-Fmoc-3-aminopyrrolidine; 3-Amino-p |
| Molecular Structure |  |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.37 |
| CAS Registry Number | 813412-37-2 |
| SMILES | O=C(OCC3c1ccccc1c2ccccc23)N4CCC(N)C4 |
| InChI | 1S/C19H20N2O2/c20-13-9-10-21(11-13)19(22)23-12-18-16-7-3-1-5-14(16)15-6-2-4-8-17(15)18/h1-8,13,18H,9-12,20H2 |
| InChIKey | BCWKNNDZLLBHEG-UHFFFAOYSA-N |
| Density | 1.237g/cm3 (Cal.) |
|---|---|
| Boiling point | 478.907°C at 760 mmHg (Cal.) |
| Flash point | 243.434°C (Cal.) |
| Refractive index | 1.627 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 9H-Fluoren-9-ylmethyl 3-amino-1-pyrrolidinecarboxylate |