Online Database of Chemicals from Around the World
| Atomax Chemicals Co., Ltd. | China | Inquire | ||
|---|---|---|---|---|
 |
+86 13417589054/ | |||
 |
info@atomaxchem.com,atomax.chemicals@gmail.com | |||
 |
QQ Chat | |||
| Chemical manufacturer | ||||
| Name | 3,3-Dichloro-2,2,4,4-Tetramethyl-Cyclobutanethione |
|---|---|
| Synonyms | 3,3-dichloro-2,2,4,4-tetramethylcyclobutanethione |
| Molecular Structure |  |
| Molecular Formula | C8H12Cl2S |
| Molecular Weight | 211.15 |
| CAS Registry Number | 814876-19-2 |
| SMILES | CC1(C(=S)C(C1(Cl)Cl)(C)C)C |
| InChI | 1S/C8H12Cl2S/c1-6(2)5(11)7(3,4)8(6,9)10/h1-4H3 |
| InChIKey | JWVNJKSTLCBZLU-UHFFFAOYSA-N |
| Density | 1.228g/cm3 (Cal.) |
|---|---|
| Boiling point | 241.752°C at 760 mmHg (Cal.) |
| Flash point | 100.009°C (Cal.) |
| Refractive index | 1.539 (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 3,3-Dichloro-2,2,4,4-Tetramethyl-Cyclobutanethione |