Online Database of Chemicals from Around the World
|
CAS#: 82389-37-5 Product: 4'-Phenylchalcone oxide No suppilers available for the product. |
| Name | 4'-Phenylchalcone oxide |
|---|---|
| Synonyms | (3-Phenyl-2-Oxiranyl)-(4-Phenylphenyl)Methanone; Methanone, (1,1'-Biphenyl)-4-Yl(3-Phenyloxiranyl)-; 4'-Phenylchalcone Oxide |
| Molecular Structure |  |
| Molecular Formula | C21H16O2 |
| Molecular Weight | 300.36 |
| CAS Registry Number | 82389-37-5 (32047-01-1) |
| SMILES | C1=CC=CC=C1C4C(C(C2=CC=C(C=C2)C3=CC=CC=C3)=O)O4 |
| InChI | 1S/C21H16O2/c22-19(21-20(23-21)18-9-5-2-6-10-18)17-13-11-16(12-14-17)15-7-3-1-4-8-15/h1-14,20-21H |
| InChIKey | YCFFVRPHPWIPTD-UHFFFAOYSA-N |
| Density | 1.198g/cm3 (Cal.) |
|---|---|
| Boiling point | 482.555°C at 760 mmHg (Cal.) |
| Flash point | 217.137°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 4'-Phenylchalcone oxide |