Online Database of Chemicals from Around the World
| Alfa Chemistry | USA | Inquire | ||
|---|---|---|---|---|
 |
+1 (201) 478-8534 | |||
 |
inquiry@alfa-chemistry.com | |||
| Chemical distributor since 2012 | ||||
| chemBlink standard supplier since 2012 | ||||
| Apollo Scientific Ltd. | UK | Inquire | ||
|---|---|---|---|---|
|
+44 (161) 406-0505 | |||
|
sales@apolloscientific.co.uk | |||
| Chemical manufacturer | ||||
| Name | Cervinomycin A2 |
|---|---|
| Synonyms | Antibiotic 167B; Antibiotic 4181-A; Antibiotic 4181A |
| Molecular Structure |  |
| Molecular Formula | C29H21NO9 |
| Molecular Weight | 527.49 |
| CAS Registry Number | 82658-22-8 |
| SMILES | C1=C(C(=CC2=C1C(C3=C(O2)C(C7=C(C3=O)C6=C(C=C5CC4(OCCN4C(C5=C6O)=O)C)C=C7)=O)=O)OC)OC |
| InChI | 1S/C29H21NO9/c1-29-11-13-8-12-4-5-14-21(19(12)25(33)20(13)28(35)30(29)6-7-38-29)26(34)22-23(31)15-9-17(36-2)18(37-3)10-16(15)39-27(22)24(14)32/h4-5,8-10,33H,6-7,11H2,1-3H3 |
| InChIKey | ORJRBJIJTSDUCG-UHFFFAOYSA-N |
| Density | 1.624g/cm3 (Cal.) |
|---|---|
| Boiling point | 806.17°C at 760 mmHg (Cal.) |
| Flash point | 441.356°C (Cal.) |
| SDS | Available |
|---|---|
| Market Analysis Reports |
| List of Reports Available for Cervinomycin A2 |