Online Database of Chemicals from Around the World
|
CAS#: 82658-23-9 Product: Cervinomycin A1 No suppilers available for the product. |
| Name | Cervinomycin A1 |
|---|---|
| Synonyms | Cervinomycin A(Sub 1); Cervinomycin A1 |
| Molecular Structure |  |
| Molecular Formula | C29H23NO9 |
| Molecular Weight | 529.50 |
| CAS Registry Number | 82658-23-9 |
| SMILES | C1=C7C(=C(O)C2=C4C(=CC=C12)C(=C3OC5=C(C(=O)C3=C4O)C=C(OC)C(=C5)OC)O)C(=O)N6C(OCC6)(C7)C |
| InChI | 1S/C29H23NO9/c1-29-11-13-8-12-4-5-14-21(19(12)25(33)20(13)28(35)30(29)6-7-38-29)26(34)22-23(31)15-9-17(36-2)18(37-3)10-16(15)39-27(22)24(14)32/h4-5,8-10,32-34H,6-7,11H2,1-3H3 |
| InChIKey | HKGLETKFBVSBOX-UHFFFAOYSA-N |
| Density | 1.66g/cm3 (Cal.) |
|---|---|
| Boiling point | 894.16°C at 760 mmHg (Cal.) |
| Flash point | 494.57°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for Cervinomycin A1 |