Online Database of Chemicals from Around the World
| Name | 1,7-Phenanthroline-5,6-Dione |
|---|---|
| Synonyms | 1,7-Phenanthroline-5,6-Quinone; Nsc 370169; 1,7-Pad |
| Molecular Structure |  |
| Molecular Formula | C12H6N2O2 |
| Molecular Weight | 210.19 |
| CAS Registry Number | 82701-91-5 |
| SMILES | C2=C1C3=C(C(=O)C(=O)C1=NC=C2)C=CC=N3 |
| InChI | 1S/C12H6N2O2/c15-11-8-4-2-5-13-9(8)7-3-1-6-14-10(7)12(11)16/h1-6H |
| InChIKey | JBLPWFLKCBTNBV-UHFFFAOYSA-N |
| Density | 1.444g/cm3 (Cal.) |
|---|---|
| Boiling point | 456.091°C at 760 mmHg (Cal.) |
| Flash point | 229.061°C (Cal.) |
| Market Analysis Reports |
| List of Reports Available for 1,7-Phenanthroline-5,6-Dione |
